C11H16INO2 — CID 43771994
N-[(5-iodofuran-2-yl)methyl]-1-(oxolan-2-yl)ethanamine (PubChem CID 43771994) has the molecular formula C11H16INO2 and a molecular weight of 321.16 g/mol. Its IUPAC name is N-[(5-iodofuran-2-yl)methyl]-1-(oxolan-2-yl)ethanamine.
| Compound Name | N-[(5-iodofuran-2-yl)methyl]-1-(oxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 43771994 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-[(5-iodofuran-2-yl)methyl]-1-(oxolan-2-yl)ethanamine |
| SMILES | CC(NCc1ccc(I)o1)C1CCCO1 |
| InChI | InChI=1S/C11H16INO2/c1-8(10-3-2-6-14-10)13-7-9-4-5-11(12)15-9/h4-5,8,10,13H,2-3,6-7H2,1H3 |
| InChIKey | CBTUJGVXVHBJTP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|