C19H29NO — CID 43772970
N-(4-propan-2-yloxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 43772970) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is N-(4-propan-2-yloxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | N-(4-propan-2-yloxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 43772970 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | N-(4-propan-2-yloxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | CC(C)Oc1ccc(NC2CCC3CCCCC3C2)cc1 |
| InChI | InChI=1S/C19H29NO/c1-14(2)21-19-11-9-17(10-12-19)20-18-8-7-15-5-3-4-6-16(15)13-18/h9-12,14-16,18,20H,3-8,13H2,1-2H3 |
| InChIKey | QDORUPNHVXTQKU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|