C15H13Br2F2NO — CID 43773097
N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2,6-difluoroaniline (PubChem CID 43773097) has the molecular formula C15H13Br2F2NO and a molecular weight of 421.08 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2,6-difluoroaniline.
| Compound Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 43773097 |
| Molecular Formula | C15H13Br2F2NO |
| Molecular Weight | 421.08 g/mol |
| Exact Mass | 418.93 |
| IUPAC Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2,6-difluoroaniline |
| SMILES | CCOc1c(Br)cc(CNc2c(F)cccc2F)cc1Br |
| InChI | InChI=1S/C15H13Br2F2NO/c1-2-21-15-10(16)6-9(7-11(15)17)8-20-14-12(18)4-3-5-13(14)19/h3-7,20H,2,8H2,1H3 |
| InChIKey | KELTVRSINUIROP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.08 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |