C15H11Cl3N2O — CID 43773657
2-[3-[(2,4,6-trichloroanilino)methyl]phenoxy]acetonitrile (PubChem CID 43773657) has the molecular formula C15H11Cl3N2O and a molecular weight of 341.63 g/mol. Its IUPAC name is 2-[3-[(2,4,6-trichloroanilino)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[3-[(2,4,6-trichloroanilino)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 43773657 |
| Molecular Formula | C15H11Cl3N2O |
| Molecular Weight | 341.63 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2-[3-[(2,4,6-trichloroanilino)methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(CNc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H11Cl3N2O/c16-11-7-13(17)15(14(18)8-11)20-9-10-2-1-3-12(6-10)21-5-4-19/h1-3,6-8,20H,5,9H2 |
| InChIKey | HAYCQLPDODNJMX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |