About 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide
2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide (PubChem CID 43775368) has the molecular formula C12H22N4OS
and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide |
| PubChem CID | 43775368 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide |
| SMILES | CCN(CC)c1ncc(CNCC(=O)N(C)C)s1 |
| InChI | InChI=1S/C12H22N4OS/c1-5-16(6-2)12-14-8-10(18-12)7-13-9-11(17)15(3)4/h8,13H,5-7,9H2,1-4H3 |
| InChIKey | ZGDLKSYXWZVUFY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide?
The IUPAC name of 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide (CID 43775368) is 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide is CCN(CC)c1ncc(CNCC(=O)N(C)C)s1.
What is the InChIKey of 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide?
The InChIKey is ZGDLKSYXWZVUFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4OS/c1-5-16(6-2)12-14-8-10(18-12)7-13-9-11(17)15(3)4/h8,13H,5-7,9H2,1-4H3.
What are the key properties of 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide?
2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide has a molecular weight of 270.40 g/mol, XLogP of 1.17, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-N,N-dimethylacetamide is sourced from PubChem (CID 43775368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).