C15H14Br2FNO2 — CID 43775873
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-fluoro-4-methoxyaniline (PubChem CID 43775873) has the molecular formula C15H14Br2FNO2 and a molecular weight of 419.09 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-fluoro-4-methoxyaniline.
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 43775873 |
| Molecular Formula | C15H14Br2FNO2 |
| Molecular Weight | 419.09 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-fluoro-4-methoxyaniline |
| SMILES | COc1ccc(NCc2cc(Br)cc(Br)c2OC)cc1F |
| InChI | InChI=1S/C15H14Br2FNO2/c1-20-14-4-3-11(7-13(14)18)19-8-9-5-10(16)6-12(17)15(9)21-2/h3-7,19H,8H2,1-2H3 |
| InChIKey | NYSDNQSUNYWVKW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.09 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|