About methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate
methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate (PubChem CID 43776174) has the molecular formula C15H21NO2S
and a molecular weight of 279.40 g/mol. Its IUPAC name is methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate |
| PubChem CID | 43776174 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC1CSCc2ccccc21)C(C)C |
| InChI | InChI=1S/C15H21NO2S/c1-10(2)14(15(17)18-3)16-13-9-19-8-11-6-4-5-7-12(11)13/h4-7,10,13-14,16H,8-9H2,1-3H3/t13?,14-/m0/s1 |
| InChIKey | FCDZFACFUYVULR-KZUDCZAMSA-N |
| XLogP | 2.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate?
The IUPAC name of methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate (CID 43776174) is methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate.
What is the SMILES notation for methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate?
The canonical SMILES for methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate is COC(=O)[C@@H](NC1CSCc2ccccc21)C(C)C.
What is the InChIKey of methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate?
The InChIKey is FCDZFACFUYVULR-KZUDCZAMSA-N. The full InChI is InChI=1S/C15H21NO2S/c1-10(2)14(15(17)18-3)16-13-9-19-8-11-6-4-5-7-12(11)13/h4-7,10,13-14,16H,8-9H2,1-3H3/t13?,14-/m0/s1.
What are the key properties of methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate?
methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate has a molecular weight of 279.40 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(3,4-dihydro-1H-isothiochromen-4-ylamino)-3-methylbutanoate is sourced from PubChem (CID 43776174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).