About 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide
2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide (PubChem CID 43777379) has the molecular formula C9H18F3N3O2S
and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide |
| PubChem CID | 43777379 |
| Molecular Formula | C9H18F3N3O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H18F3N3O2S/c10-9(11,12)7-15-4-1-8(2-5-15)14-3-6-18(13,16)17/h8,14H,1-7H2,(H2,13,16,17) |
| InChIKey | KXWCQLLWCONMLF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide?
The IUPAC name of 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide (CID 43777379) is 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide.
What is the SMILES notation for 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide?
The canonical SMILES for 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide is NS(=O)(=O)CCNC1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide?
The InChIKey is KXWCQLLWCONMLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3N3O2S/c10-9(11,12)7-15-4-1-8(2-5-15)14-3-6-18(13,16)17/h8,14H,1-7H2,(H2,13,16,17).
What are the key properties of 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide?
2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide has a molecular weight of 289.32 g/mol, XLogP of -0.11, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]ethanesulfonamide is sourced from PubChem (CID 43777379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).