C11H19NO — CID 43778401
N-(2-ethoxyethyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 43778401) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-(2-ethoxyethyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(2-ethoxyethyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 43778401 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-(2-ethoxyethyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | CCOCCNC1CC2CC=CC21 |
| InChI | InChI=1S/C11H19NO/c1-2-13-7-6-12-11-8-9-4-3-5-10(9)11/h3,5,9-12H,2,4,6-8H2,1H3 |
| InChIKey | ANBOVTDSMDSYQA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|