C13H23N3OS — CID 43778486
N,N-diethyl-5-[(oxan-4-ylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 43778486) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is N,N-diethyl-5-[(oxan-4-ylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-5-[(oxan-4-ylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43778486 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N,N-diethyl-5-[(oxan-4-ylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(CNC2CCOCC2)s1 |
| InChI | InChI=1S/C13H23N3OS/c1-3-16(4-2)13-15-10-12(18-13)9-14-11-5-7-17-8-6-11/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | XFEXSVIJWCLWHE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |