About 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine
3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine (PubChem CID 43779998) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine.
Molecular Properties
| Compound Name | 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine |
| PubChem CID | 43779998 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine |
| SMILES | COc1nccc(N(C)C)c1NC1CC2CC=CC21 |
| InChI | InChI=1S/C15H21N3O/c1-18(2)13-7-8-16-15(19-3)14(13)17-12-9-10-5-4-6-11(10)12/h4,6-8,10-12,17H,5,9H2,1-3H3 |
| InChIKey | QPTIHKVAFBVQQP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine?
The IUPAC name of 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine (CID 43779998) is 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine.
What is the SMILES notation for 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine?
The canonical SMILES for 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine is COc1nccc(N(C)C)c1NC1CC2CC=CC21.
What is the InChIKey of 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine?
The InChIKey is QPTIHKVAFBVQQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-18(2)13-7-8-16-15(19-3)14(13)17-12-9-10-5-4-6-11(10)12/h4,6-8,10-12,17H,5,9H2,1-3H3.
What are the key properties of 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine?
3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine has a molecular weight of 259.35 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(6-bicyclo[3.2.0]hept-3-enyl)-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine is sourced from PubChem (CID 43779998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).