About N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine (PubChem CID 43780109) has the molecular formula C13H17Br2NO3S
and a molecular weight of 427.16 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 43780109 |
| Molecular Formula | C13H17Br2NO3S |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine |
| SMILES | COc1c(Br)cc(Br)cc1CNC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17Br2NO3S/c1-13(3-4-20(17,18)8-13)16-7-9-5-10(14)6-11(15)12(9)19-2/h5-6,16H,3-4,7-8H2,1-2H3 |
| InChIKey | SVUUENOGDBBKSO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine (CID 43780109) is N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine is COc1c(Br)cc(Br)cc1CNC1(C)CCS(=O)(=O)C1.
What is the InChIKey of N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is SVUUENOGDBBKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Br2NO3S/c1-13(3-4-20(17,18)8-13)16-7-9-5-10(14)6-11(15)12(9)19-2/h5-6,16H,3-4,7-8H2,1-2H3.
What are the key properties of N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine?
N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 427.16 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dibromo-2-methoxyphenyl)methyl]-3-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 43780109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).