C18H30N2O — CID 43781317
2-[(3,3-dimethyl-1-phenylbutyl)amino]-N-propylpropanamide (PubChem CID 43781317) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-[(3,3-dimethyl-1-phenylbutyl)amino]-N-propylpropanamide.
| Compound Name | 2-[(3,3-dimethyl-1-phenylbutyl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 43781317 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2-[(3,3-dimethyl-1-phenylbutyl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NC(CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O/c1-6-12-19-17(21)14(2)20-16(13-18(3,4)5)15-10-8-7-9-11-15/h7-11,14,16,20H,6,12-13H2,1-5H3,(H,19,21) |
| InChIKey | QOIBOWLLBAYODA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |