About 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one
3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one (PubChem CID 43782018) has the molecular formula C14H24N4OS
and a molecular weight of 296.44 g/mol. Its IUPAC name is 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one.
Molecular Properties
| Compound Name | 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one |
| PubChem CID | 43782018 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one |
| SMILES | CCN(CC)c1ncc(CNC2CCCCNC2=O)s1 |
| InChI | InChI=1S/C14H24N4OS/c1-3-18(4-2)14-17-10-11(20-14)9-16-12-7-5-6-8-15-13(12)19/h10,12,16H,3-9H2,1-2H3,(H,15,19) |
| InChIKey | TURKTOKWKUECJQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one?
The IUPAC name of 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one (CID 43782018) is 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one.
What is the SMILES notation for 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one?
The canonical SMILES for 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one is CCN(CC)c1ncc(CNC2CCCCNC2=O)s1.
What is the InChIKey of 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one?
The InChIKey is TURKTOKWKUECJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4OS/c1-3-18(4-2)14-17-10-11(20-14)9-16-12-7-5-6-8-15-13(12)19/h10,12,16H,3-9H2,1-2H3,(H,15,19).
What are the key properties of 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one?
3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one has a molecular weight of 296.44 g/mol, XLogP of 1.75, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]azepan-2-one is sourced from PubChem (CID 43782018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).