C11H15IN2O2 — CID 43782035
3-[(5-iodofuran-2-yl)methylamino]azepan-2-one (PubChem CID 43782035) has the molecular formula C11H15IN2O2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 3-[(5-iodofuran-2-yl)methylamino]azepan-2-one.
| Compound Name | 3-[(5-iodofuran-2-yl)methylamino]azepan-2-one |
|---|---|
| PubChem CID | 43782035 |
| Molecular Formula | C11H15IN2O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-[(5-iodofuran-2-yl)methylamino]azepan-2-one |
| SMILES | O=C1NCCCCC1NCc1ccc(I)o1 |
| InChI | InChI=1S/C11H15IN2O2/c12-10-5-4-8(16-10)7-14-9-3-1-2-6-13-11(9)15/h4-5,9,14H,1-3,6-7H2,(H,13,15) |
| InChIKey | IBUJHELDZODSQS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|