C18H25N — CID 43783255
N-(2,2-dimethyl-1-phenylpropyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 43783255) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is N-(2,2-dimethyl-1-phenylpropyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(2,2-dimethyl-1-phenylpropyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 43783255 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | N-(2,2-dimethyl-1-phenylpropyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | CC(C)(C)C(NC1CC2CC=CC21)c1ccccc1 |
| InChI | InChI=1S/C18H25N/c1-18(2,3)17(13-8-5-4-6-9-13)19-16-12-14-10-7-11-15(14)16/h4-9,11,14-17,19H,10,12H2,1-3H3 |
| InChIKey | XXVQFKLSSXWBOQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|