C14H12N4O2Se — CID 43784852
N-[(4-methyl-3-nitrophenyl)methyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43784852) has the molecular formula C14H12N4O2Se and a molecular weight of 347.24 g/mol. Its IUPAC name is N-[(4-methyl-3-nitrophenyl)methyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[(4-methyl-3-nitrophenyl)methyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43784852 |
| Molecular Formula | C14H12N4O2Se |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | N-[(4-methyl-3-nitrophenyl)methyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | Cc1ccc(CNc2cccc3n[se]nc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N4O2Se/c1-9-5-6-10(7-13(9)18(19)20)8-15-11-3-2-4-12-14(11)17-21-16-12/h2-7,15H,8H2,1H3 |
| InChIKey | CWUNOGZLZPZOID-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|