C17H20IN — CID 43784979
3-iodo-4-methyl-N-[(2,4,5-trimethylphenyl)methyl]aniline (PubChem CID 43784979) has the molecular formula C17H20IN and a molecular weight of 365.26 g/mol. Its IUPAC name is 3-iodo-4-methyl-N-[(2,4,5-trimethylphenyl)methyl]aniline.
| Compound Name | 3-iodo-4-methyl-N-[(2,4,5-trimethylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 43784979 |
| Molecular Formula | C17H20IN |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 3-iodo-4-methyl-N-[(2,4,5-trimethylphenyl)methyl]aniline |
| SMILES | Cc1cc(C)c(CNc2ccc(C)c(I)c2)cc1C |
| InChI | InChI=1S/C17H20IN/c1-11-5-6-16(9-17(11)18)19-10-15-8-13(3)12(2)7-14(15)4/h5-9,19H,10H2,1-4H3 |
| InChIKey | JDNUKDJAILHQSC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|