C16H14Cl2INO — CID 43785265
6,8-dichloro-N-(4-iodo-2-methylphenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43785265) has the molecular formula C16H14Cl2INO and a molecular weight of 434.10 g/mol. Its IUPAC name is 6,8-dichloro-N-(4-iodo-2-methylphenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6,8-dichloro-N-(4-iodo-2-methylphenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43785265 |
| Molecular Formula | C16H14Cl2INO |
| Molecular Weight | 434.10 g/mol |
| Exact Mass | 432.95 |
| IUPAC Name | 6,8-dichloro-N-(4-iodo-2-methylphenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | Cc1cc(I)ccc1NC1CCOc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C16H14Cl2INO/c1-9-6-11(19)2-3-14(9)20-15-4-5-21-16-12(15)7-10(17)8-13(16)18/h2-3,6-8,15,20H,4-5H2,1H3 |
| InChIKey | NLSXRERYWDDESH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.10 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|