C18H24FNO — CID 43786850
1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]ethanamine (PubChem CID 43786850) has the molecular formula C18H24FNO and a molecular weight of 289.39 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]ethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 43786850 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]ethanamine |
| SMILES | COc1ccc(C(C)NC(C)C2CC3C=CC2C3)cc1F |
| InChI | InChI=1S/C18H24FNO/c1-11(14-6-7-18(21-3)17(19)10-14)20-12(2)16-9-13-4-5-15(16)8-13/h4-7,10-13,15-16,20H,8-9H2,1-3H3 |
| InChIKey | WUDJEDUFCFWZKH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|