C16H20N4 — CID 43787087
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine (PubChem CID 43787087) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
|---|---|
| PubChem CID | 43787087 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
| SMILES | Cc1nn(C)c2ncc(NCC3CC4C=CC3C4)cc12 |
| InChI | InChI=1S/C16H20N4/c1-10-15-7-14(9-18-16(15)20(2)19-10)17-8-13-6-11-3-4-12(13)5-11/h3-4,7,9,11-13,17H,5-6,8H2,1-2H3 |
| InChIKey | XIKXAFGRXJEAFR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|