C19H26N2 — CID 43787294
2-N,2-N-dimethyl-1-N-(1-phenylpentyl)benzene-1,2-diamine (PubChem CID 43787294) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-(1-phenylpentyl)benzene-1,2-diamine.
| Compound Name | 2-N,2-N-dimethyl-1-N-(1-phenylpentyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43787294 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-(1-phenylpentyl)benzene-1,2-diamine |
| SMILES | CCCCC(Nc1ccccc1N(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H26N2/c1-4-5-13-17(16-11-7-6-8-12-16)20-18-14-9-10-15-19(18)21(2)3/h6-12,14-15,17,20H,4-5,13H2,1-3H3 |
| InChIKey | IVICVOYYGYTCML-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |