About N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine
N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43787357) has the molecular formula C17H29NO
and a molecular weight of 263.42 g/mol. Its IUPAC name is N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 43787357 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | COC1CCCCC1NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H29NO/c1-19-17-8-3-2-7-15(17)18-16-10-11-9-14(16)13-6-4-5-12(11)13/h11-18H,2-10H2,1H3 |
| InChIKey | BBFVADOZEXWRHQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine (CID 43787357) is N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine is COC1CCCCC1NC1CC2CC1C1CCCC21.
What is the InChIKey of N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is BBFVADOZEXWRHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO/c1-19-17-8-3-2-7-15(17)18-16-10-11-9-14(16)13-6-4-5-12(11)13/h11-18H,2-10H2,1H3.
What are the key properties of N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine?
N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 263.42 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxycyclohexyl)tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 43787357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).