C17H19NO2 — CID 43787480
4-methyl-3-[1-(3-methylphenyl)ethylamino]benzoic acid (PubChem CID 43787480) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-methyl-3-[1-(3-methylphenyl)ethylamino]benzoic acid.
| Compound Name | 4-methyl-3-[1-(3-methylphenyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 43787480 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-methyl-3-[1-(3-methylphenyl)ethylamino]benzoic acid |
| SMILES | Cc1cccc(C(C)Nc2cc(C(=O)O)ccc2C)c1 |
| InChI | InChI=1S/C17H19NO2/c1-11-5-4-6-14(9-11)13(3)18-16-10-15(17(19)20)8-7-12(16)2/h4-10,13,18H,1-3H3,(H,19,20) |
| InChIKey | PCNURWBHVUCUDT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |