About N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine
N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine (PubChem CID 43787749) has the molecular formula C15H18FN3OS
and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine |
| PubChem CID | 43787749 |
| Molecular Formula | C15H18FN3OS |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine |
| SMILES | COCCn1cc(NC2CCSc3c(F)cccc32)cn1 |
| InChI | InChI=1S/C15H18FN3OS/c1-20-7-6-19-10-11(9-17-19)18-14-5-8-21-15-12(14)3-2-4-13(15)16/h2-4,9-10,14,18H,5-8H2,1H3 |
| InChIKey | HLYMVSFLYJQJCE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine?
The IUPAC name of N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine (CID 43787749) is N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine.
What is the SMILES notation for N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine?
The canonical SMILES for N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine is COCCn1cc(NC2CCSc3c(F)cccc32)cn1.
What is the InChIKey of N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine?
The InChIKey is HLYMVSFLYJQJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN3OS/c1-20-7-6-19-10-11(9-17-19)18-14-5-8-21-15-12(14)3-2-4-13(15)16/h2-4,9-10,14,18H,5-8H2,1H3.
What are the key properties of N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine?
N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine has a molecular weight of 307.39 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-methoxyethyl)pyrazol-4-amine is sourced from PubChem (CID 43787749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).