About N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine
N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 43788077) has the molecular formula C13H19F3N2S
and a molecular weight of 292.37 g/mol. Its IUPAC name is N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine |
| PubChem CID | 43788077 |
| Molecular Formula | C13H19F3N2S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | Cc1ncsc1C(C)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2S/c1-8-12(19-7-17-8)9(2)18-11-6-4-3-5-10(11)13(14,15)16/h7,9-11,18H,3-6H2,1-2H3 |
| InChIKey | LHZNZBFOSWWHBD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine?
The IUPAC name of N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine (CID 43788077) is N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine.
What is the SMILES notation for N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine?
The canonical SMILES for N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine is Cc1ncsc1C(C)NC1CCCCC1C(F)(F)F.
What is the InChIKey of N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine?
The InChIKey is LHZNZBFOSWWHBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2S/c1-8-12(19-7-17-8)9(2)18-11-6-4-3-5-10(11)13(14,15)16/h7,9-11,18H,3-6H2,1-2H3.
What are the key properties of N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine?
N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine has a molecular weight of 292.37 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)cyclohexan-1-amine is sourced from PubChem (CID 43788077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).