C14H17F3N4 — CID 43788150
N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-indazol-7-amine (PubChem CID 43788150) has the molecular formula C14H17F3N4 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-indazol-7-amine.
| Compound Name | N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-indazol-7-amine |
|---|---|
| PubChem CID | 43788150 |
| Molecular Formula | C14H17F3N4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-1H-indazol-7-amine |
| SMILES | FC(F)(F)CN1CCC(Nc2cccc3cn[nH]c23)CC1 |
| InChI | InChI=1S/C14H17F3N4/c15-14(16,17)9-21-6-4-11(5-7-21)19-12-3-1-2-10-8-18-20-13(10)12/h1-3,8,11,19H,4-7,9H2,(H,18,20) |
| InChIKey | HKKUOZDFWDHGNZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |