C16H17N3 — CID 43790642
N-[(3,4-dimethylphenyl)methyl]-1H-indazol-6-amine (PubChem CID 43790642) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-1H-indazol-6-amine.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-1H-indazol-6-amine |
|---|---|
| PubChem CID | 43790642 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-1H-indazol-6-amine |
| SMILES | Cc1ccc(CNc2ccc3cn[nH]c3c2)cc1C |
| InChI | InChI=1S/C16H17N3/c1-11-3-4-13(7-12(11)2)9-17-15-6-5-14-10-18-19-16(14)8-15/h3-8,10,17H,9H2,1-2H3,(H,18,19) |
| InChIKey | AHOKZULHOLYHBS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |