About 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one
6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one (PubChem CID 43793801) has the molecular formula C9H14F4O2
and a molecular weight of 230.20 g/mol. Its IUPAC name is 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one.
Molecular Properties
| Compound Name | 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one |
| PubChem CID | 43793801 |
| Molecular Formula | C9H14F4O2 |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one |
| SMILES | CC(=O)CCCCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H14F4O2/c1-7(14)4-2-3-5-15-6-9(12,13)8(10)11/h8H,2-6H2,1H3 |
| InChIKey | XKVLYDGMFTZKIG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one?
The IUPAC name of 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one (CID 43793801) is 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one.
What is the SMILES notation for 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one?
The canonical SMILES for 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one is CC(=O)CCCCOCC(F)(F)C(F)F.
What is the InChIKey of 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one?
The InChIKey is XKVLYDGMFTZKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F4O2/c1-7(14)4-2-3-5-15-6-9(12,13)8(10)11/h8H,2-6H2,1H3.
What are the key properties of 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one?
6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one has a molecular weight of 230.20 g/mol, XLogP of 2.66, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2,3,3-tetrafluoropropoxy)hexan-2-one is sourced from PubChem (CID 43793801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).