C13H15Cl2NO — CID 43794977
2-[cyclopropyl(ethyl)amino]-1-(2,4-dichlorophenyl)ethanone (PubChem CID 43794977) has the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. Its IUPAC name is 2-[cyclopropyl(ethyl)amino]-1-(2,4-dichlorophenyl)ethanone.
| Compound Name | 2-[cyclopropyl(ethyl)amino]-1-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 43794977 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-[cyclopropyl(ethyl)amino]-1-(2,4-dichlorophenyl)ethanone |
| SMILES | CCN(CC(=O)c1ccc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C13H15Cl2NO/c1-2-16(10-4-5-10)8-13(17)11-6-3-9(14)7-12(11)15/h3,6-7,10H,2,4-5,8H2,1H3 |
| InChIKey | OPKQGLKUZLQBGH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |