C11H18N2O — CID 43795802
2-[butan-2-yl(methyl)amino]-1-(1H-pyrrol-2-yl)ethanone (PubChem CID 43795802) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-[butan-2-yl(methyl)amino]-1-(1H-pyrrol-2-yl)ethanone.
| Compound Name | 2-[butan-2-yl(methyl)amino]-1-(1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 43795802 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-[butan-2-yl(methyl)amino]-1-(1H-pyrrol-2-yl)ethanone |
| SMILES | CCC(C)N(C)CC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C11H18N2O/c1-4-9(2)13(3)8-11(14)10-6-5-7-12-10/h5-7,9,12H,4,8H2,1-3H3 |
| InChIKey | BDGWDWCMHRWFNX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |