About 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone
1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 43798117) has the molecular formula C9H9N3OS
and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone |
| PubChem CID | 43798117 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | Cc1ccc(C(=O)Cn2cncn2)s1 |
| InChI | InChI=1S/C9H9N3OS/c1-7-2-3-9(14-7)8(13)4-12-6-10-5-11-12/h2-3,5-6H,4H2,1H3 |
| InChIKey | DLPUGFMRRLAILH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The IUPAC name of 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone (CID 43798117) is 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone.
What is the SMILES notation for 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The canonical SMILES for 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone is Cc1ccc(C(=O)Cn2cncn2)s1.
What is the InChIKey of 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The InChIKey is DLPUGFMRRLAILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS/c1-7-2-3-9(14-7)8(13)4-12-6-10-5-11-12/h2-3,5-6H,4H2,1H3.
What are the key properties of 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone?
1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone has a molecular weight of 207.26 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methylthiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone is sourced from PubChem (CID 43798117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).