About 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone
1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 43798156) has the molecular formula C8H6BrN3OS
and a molecular weight of 272.13 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone |
| PubChem CID | 43798156 |
| Molecular Formula | C8H6BrN3OS |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cncn1)c1sccc1Br |
| InChI | InChI=1S/C8H6BrN3OS/c9-6-1-2-14-8(6)7(13)3-12-5-10-4-11-12/h1-2,4-5H,3H2 |
| InChIKey | TWMDFKZCUXISMY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The IUPAC name of 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone (CID 43798156) is 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone.
What is the SMILES notation for 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The canonical SMILES for 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone is O=C(Cn1cncn1)c1sccc1Br.
What is the InChIKey of 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone?
The InChIKey is TWMDFKZCUXISMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3OS/c9-6-1-2-14-8(6)7(13)3-12-5-10-4-11-12/h1-2,4-5H,3H2.
What are the key properties of 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone?
1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone has a molecular weight of 272.13 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromothiophen-2-yl)-2-(1,2,4-triazol-1-yl)ethanone is sourced from PubChem (CID 43798156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).