C16H18O4S — CID 43799632
2-(2,6-dimethoxyphenoxy)-1-(5-ethylthiophen-2-yl)ethanone (PubChem CID 43799632) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-1-(5-ethylthiophen-2-yl)ethanone.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-1-(5-ethylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 43799632 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-1-(5-ethylthiophen-2-yl)ethanone |
| SMILES | CCc1ccc(C(=O)COc2c(OC)cccc2OC)s1 |
| InChI | InChI=1S/C16H18O4S/c1-4-11-8-9-15(21-11)12(17)10-20-16-13(18-2)6-5-7-14(16)19-3/h5-9H,4,10H2,1-3H3 |
| InChIKey | PTVKDSYCWRPYBI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |