C16H22Cl2O2 — CID 43800020
1-(3,4-dichlorophenyl)-2-octan-2-yloxyethanone (PubChem CID 43800020) has the molecular formula C16H22Cl2O2 and a molecular weight of 317.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-octan-2-yloxyethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-octan-2-yloxyethanone |
|---|---|
| PubChem CID | 43800020 |
| Molecular Formula | C16H22Cl2O2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-octan-2-yloxyethanone |
| SMILES | CCCCCCC(C)OCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2O2/c1-3-4-5-6-7-12(2)20-11-16(19)13-8-9-14(17)15(18)10-13/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | RARSDCXCYKBUMM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|