C14H9Cl2NO3S — CID 43801532
1-(3,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanylethanone (PubChem CID 43801532) has the molecular formula C14H9Cl2NO3S and a molecular weight of 342.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanylethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 43801532 |
| Molecular Formula | C14H9Cl2NO3S |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(2-nitrophenyl)sulfanylethanone |
| SMILES | O=C(CSc1ccccc1[N+](=O)[O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2NO3S/c15-10-6-5-9(7-11(10)16)13(18)8-21-14-4-2-1-3-12(14)17(19)20/h1-7H,8H2 |
| InChIKey | WVTXWEPMOVNQDK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|