C15H12F3NOS — CID 43802334
1-(3-methylphenyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone (PubChem CID 43802334) has the molecular formula C15H12F3NOS and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone.
| Compound Name | 1-(3-methylphenyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 43802334 |
| Molecular Formula | C15H12F3NOS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-(3-methylphenyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
| SMILES | Cc1cccc(C(=O)CSc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C15H12F3NOS/c1-10-3-2-4-11(7-10)13(20)9-21-14-6-5-12(8-19-14)15(16,17)18/h2-8H,9H2,1H3 |
| InChIKey | ZFJPNBSKCZRJEB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |