C16H16N2 — CID 43802813
2-naphthalen-2-yl-2-pyrrolidin-1-ylacetonitrile (PubChem CID 43802813) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-naphthalen-2-yl-2-pyrrolidin-1-ylacetonitrile.
| Compound Name | 2-naphthalen-2-yl-2-pyrrolidin-1-ylacetonitrile |
|---|---|
| PubChem CID | 43802813 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-naphthalen-2-yl-2-pyrrolidin-1-ylacetonitrile |
| SMILES | N#CC(c1ccc2ccccc2c1)N1CCCC1 |
| InChI | InChI=1S/C16H16N2/c17-12-16(18-9-3-4-10-18)15-8-7-13-5-1-2-6-14(13)11-15/h1-2,5-8,11,16H,3-4,9-10H2 |
| InChIKey | FZGNVLIUSFZTDP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |