About 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile
2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile (PubChem CID 43802879) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile.
Molecular Properties
| Compound Name | 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile |
| PubChem CID | 43802879 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile |
| SMILES | Cc1cc(C(C#N)N2CCCCC2)cc(C)c1O |
| InChI | InChI=1S/C15H20N2O/c1-11-8-13(9-12(2)15(11)18)14(10-16)17-6-4-3-5-7-17/h8-9,14,18H,3-7H2,1-2H3 |
| InChIKey | ONXIJUCMAMLVJF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile?
The IUPAC name of 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile (CID 43802879) is 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile.
What is the SMILES notation for 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile?
The canonical SMILES for 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile is Cc1cc(C(C#N)N2CCCCC2)cc(C)c1O.
What is the InChIKey of 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile?
The InChIKey is ONXIJUCMAMLVJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c1-11-8-13(9-12(2)15(11)18)14(10-16)17-6-4-3-5-7-17/h8-9,14,18H,3-7H2,1-2H3.
What are the key properties of 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile?
2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile has a molecular weight of 244.34 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-3,5-dimethylphenyl)-2-piperidin-1-ylacetonitrile is sourced from PubChem (CID 43802879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).