C15H23NO4 — CID 43803665
2-(diethylamino)-2-(3,4-dimethoxyphenyl)propanoic acid (PubChem CID 43803665) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-(diethylamino)-2-(3,4-dimethoxyphenyl)propanoic acid.
| Compound Name | 2-(diethylamino)-2-(3,4-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 43803665 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(diethylamino)-2-(3,4-dimethoxyphenyl)propanoic acid |
| SMILES | CCN(CC)C(C)(C(=O)O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23NO4/c1-6-16(7-2)15(3,14(17)18)11-8-9-12(19-4)13(10-11)20-5/h8-10H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | ZFTIOIDEOAVONX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |