C12H15F2NO2 — CID 43803709
2-(diethylamino)-2-(2,4-difluorophenyl)acetic acid (PubChem CID 43803709) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-(diethylamino)-2-(2,4-difluorophenyl)acetic acid.
| Compound Name | 2-(diethylamino)-2-(2,4-difluorophenyl)acetic acid |
|---|---|
| PubChem CID | 43803709 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-(diethylamino)-2-(2,4-difluorophenyl)acetic acid |
| SMILES | CCN(CC)C(C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2NO2/c1-3-15(4-2)11(12(16)17)9-6-5-8(13)7-10(9)14/h5-7,11H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | JGZDWZLTLOQNAG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |