3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid

C12H17NO3S — CID 43805690

IUPAC3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid
SMILESO=C(O)CCn1c(C2CCCCC2)csc1=O
InChIInChI=1S/C12H17NO3S/c14-11(15)6-7-13-10(8-17-12(13)16)9-4-2-1-3-5-9/h8-9H,1-7H2,(H,14,15)
InChIKeyOLFRKOCWIYJVRA-UHFFFAOYSA-N
MW255.34 g/mol
LogP2.43
Rot. Bonds4

About 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid

3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid (PubChem CID 43805690) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid
PubChem CID43805690
Molecular FormulaC12H17NO3S
Molecular Weight255.34 g/mol
Exact Mass255.09
IUPAC Name3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid
SMILESO=C(O)CCn1c(C2CCCCC2)csc1=O
InChIInChI=1S/C12H17NO3S/c14-11(15)6-7-13-10(8-17-12(13)16)9-4-2-1-3-5-9/h8-9H,1-7H2,(H,14,15)
InChIKeyOLFRKOCWIYJVRA-UHFFFAOYSA-N
XLogP2.43
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.34
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid?
The IUPAC name of 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid (CID 43805690) is 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid.
What is the SMILES notation for 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid?
The canonical SMILES for 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid is O=C(O)CCn1c(C2CCCCC2)csc1=O.
What is the InChIKey of 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid?
The InChIKey is OLFRKOCWIYJVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3S/c14-11(15)6-7-13-10(8-17-12(13)16)9-4-2-1-3-5-9/h8-9H,1-7H2,(H,14,15).
What are the key properties of 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid?
3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid has a molecular weight of 255.34 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-cyclohexyl-2-oxo-1,3-thiazol-3-yl)propanoic acid is sourced from PubChem (CID 43805690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).