C13H10Br2N2O — CID 43806322
5-bromo-N-(5-bromo-2-methylphenyl)pyridine-3-carboxamide (PubChem CID 43806322) has the molecular formula C13H10Br2N2O and a molecular weight of 370.04 g/mol. Its IUPAC name is 5-bromo-N-(5-bromo-2-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(5-bromo-2-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43806322 |
| Molecular Formula | C13H10Br2N2O |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | 5-bromo-N-(5-bromo-2-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(Br)cc1NC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C13H10Br2N2O/c1-8-2-3-10(14)5-12(8)17-13(18)9-4-11(15)7-16-6-9/h2-7H,1H3,(H,17,18) |
| InChIKey | HTSZMAKPTQLEGU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |