C11H16ClN3S — CID 43808328
3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-4-chloro-1,2,5-thiadiazole (PubChem CID 43808328) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-4-chloro-1,2,5-thiadiazole.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-4-chloro-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 43808328 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-4-chloro-1,2,5-thiadiazole |
| SMILES | Clc1nsnc1N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C11H16ClN3S/c12-10-11(14-16-13-10)15-6-5-8-3-1-2-4-9(8)7-15/h8-9H,1-7H2 |
| InChIKey | RCHUOPVUQYOBES-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |