About 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole
3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole (PubChem CID 43808351) has the molecular formula C8H4ClFN2S2
and a molecular weight of 246.72 g/mol. Its IUPAC name is 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole.
Analyze 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole?
The IUPAC name of 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole (CID 43808351) is 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole.
What is the SMILES notation for 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole?
The canonical SMILES for 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole is Fc1ccccc1Sc1nsnc1Cl.
What is the InChIKey of 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole?
The InChIKey is PZCZCXGXWINISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClFN2S2/c9-7-8(12-14-11-7)13-6-4-2-1-3-5(6)10/h1-4H.
What are the key properties of 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole?
3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole has a molecular weight of 246.72 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(2-fluorophenyl)sulfanyl-1,2,5-thiadiazole is sourced from PubChem (CID 43808351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).