About 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole
3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole (PubChem CID 43808354) has the molecular formula C10H9ClN2S2
and a molecular weight of 256.78 g/mol. Its IUPAC name is 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole |
| PubChem CID | 43808354 |
| Molecular Formula | C10H9ClN2S2 |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole |
| SMILES | Cc1ccc(Sc2nsnc2Cl)c(C)c1 |
| InChI | InChI=1S/C10H9ClN2S2/c1-6-3-4-8(7(2)5-6)14-10-9(11)12-15-13-10/h3-5H,1-2H3 |
| InChIKey | QSVDTPULAXLWCC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole?
The IUPAC name of 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole (CID 43808354) is 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole.
What is the SMILES notation for 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole?
The canonical SMILES for 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole is Cc1ccc(Sc2nsnc2Cl)c(C)c1.
What is the InChIKey of 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole?
The InChIKey is QSVDTPULAXLWCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2S2/c1-6-3-4-8(7(2)5-6)14-10-9(11)12-15-13-10/h3-5H,1-2H3.
What are the key properties of 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole?
3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole has a molecular weight of 256.78 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(2,4-dimethylphenyl)sulfanyl-1,2,5-thiadiazole is sourced from PubChem (CID 43808354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).