C10H8ClFO2 — CID 43810289
2-(2-chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid (PubChem CID 43810289) has the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-(2-chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 43810289 |
| Molecular Formula | C10H8ClFO2 |
| Molecular Weight | 214.62 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1c1c(F)cccc1Cl |
| InChI | InChI=1S/C10H8ClFO2/c11-7-2-1-3-8(12)9(7)5-4-6(5)10(13)14/h1-3,5-6H,4H2,(H,13,14) |
| InChIKey | NVHNBFOVILMVRL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.62 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |