About 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride
4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride (PubChem CID 43810469) has the molecular formula C5H9ClN4
and a molecular weight of 160.61 g/mol. Its IUPAC name is 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride.
Analyze 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride?
The IUPAC name of 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride (CID 43810469) is 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride.
What is the SMILES notation for 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride?
The canonical SMILES for 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride is Cl.c1nnn2c1CNCC2.
What is the InChIKey of 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride?
The InChIKey is LYAFWMFNHSJTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4.ClH/c1-2-9-5(3-6-1)4-7-8-9;/h4,6H,1-3H2;1H.
What are the key properties of 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride?
4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride has a molecular weight of 160.61 g/mol, XLogP of -0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine;hydrochloride is sourced from PubChem (CID 43810469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).