About 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride
2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride (PubChem CID 43810718) has the molecular formula C6H16Cl2N2O2S
and a molecular weight of 251.18 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride |
| PubChem CID | 43810718 |
| Molecular Formula | C6H16Cl2N2O2S |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C6H14N2O2S.2ClH/c7-1-2-8-3-5-11(9,10)6-4-8;;/h1-7H2;2*1H |
| InChIKey | VEEGGSIXQDYQMN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride?
The IUPAC name of 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride (CID 43810718) is 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride.
What is the SMILES notation for 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride?
The canonical SMILES for 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride is Cl.Cl.NCCN1CCS(=O)(=O)CC1.
What is the InChIKey of 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride?
The InChIKey is VEEGGSIXQDYQMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2S.2ClH/c7-1-2-8-3-5-11(9,10)6-4-8;;/h1-7H2;2*1H.
What are the key properties of 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride?
2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride has a molecular weight of 251.18 g/mol, XLogP of -0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanamine;dihydrochloride is sourced from PubChem (CID 43810718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).