About 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride
3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride (PubChem CID 43810775) has the molecular formula C10H11ClN2O2S
and a molecular weight of 258.73 g/mol. Its IUPAC name is 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride |
| PubChem CID | 43810775 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride |
| SMILES | Cc1cc(C)c2c(N)c(C(=O)O)sc2n1.Cl |
| InChI | InChI=1S/C10H10N2O2S.ClH/c1-4-3-5(2)12-9-6(4)7(11)8(15-9)10(13)14;/h3H,11H2,1-2H3,(H,13,14);1H |
| InChIKey | OTBVIQHLDXAGOH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride?
The IUPAC name of 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride (CID 43810775) is 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride.
What is the SMILES notation for 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride?
The canonical SMILES for 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride is Cc1cc(C)c2c(N)c(C(=O)O)sc2n1.Cl.
What is the InChIKey of 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride?
The InChIKey is OTBVIQHLDXAGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S.ClH/c1-4-3-5(2)12-9-6(4)7(11)8(15-9)10(13)14;/h3H,11H2,1-2H3,(H,13,14);1H.
What are the key properties of 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride?
3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride has a molecular weight of 258.73 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 43810775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).